C23H23N5OS2 — CID 41189202
2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 41189202) has the molecular formula C23H23N5OS2 and a molecular weight of 449.61 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 41189202 |
| Molecular Formula | C23H23N5OS2 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)Nc2nc(-c3cc(C)c(C)cc3C)cs2)cc1 |
| InChI | InChI=1S/C23H23N5OS2/c1-13-5-7-17(8-6-13)21-26-27-23(30)28(21)11-20(29)25-22-24-19(12-31-22)18-10-15(3)14(2)9-16(18)4/h5-10,12H,11H2,1-4H3,(H,27,30)(H,24,25,29) |
| InChIKey | YSRGRQQUJGZDDS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|