C18H26N4O5S — CID 30149467
2-[ethyl(methylsulfonyl)amino]-N-(3-imidazol-1-ylpropyl)-4,5-dimethoxybenzamide (PubChem CID 30149467) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[ethyl(methylsulfonyl)amino]-N-(3-imidazol-1-ylpropyl)-4,5-dimethoxybenzamide.
| Compound Name | 2-[ethyl(methylsulfonyl)amino]-N-(3-imidazol-1-ylpropyl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 30149467 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[ethyl(methylsulfonyl)amino]-N-(3-imidazol-1-ylpropyl)-4,5-dimethoxybenzamide |
| SMILES | CCN(c1cc(OC)c(OC)cc1C(=O)NCCCn1ccnc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H26N4O5S/c1-5-22(28(4,24)25)15-12-17(27-3)16(26-2)11-14(15)18(23)20-7-6-9-21-10-8-19-13-21/h8,10-13H,5-7,9H2,1-4H3,(H,20,23) |
| InChIKey | BCBXBAJCQSOONH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|