C9H17N3O4S — CID 3016679
2-amino-4-[(2-aminoacetyl)amino]-6-methylsulfanyl-3-oxohexanoic acid (PubChem CID 3016679) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-amino-4-[(2-aminoacetyl)amino]-6-methylsulfanyl-3-oxohexanoic acid.
| Compound Name | 2-amino-4-[(2-aminoacetyl)amino]-6-methylsulfanyl-3-oxohexanoic acid |
|---|---|
| PubChem CID | 3016679 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-amino-4-[(2-aminoacetyl)amino]-6-methylsulfanyl-3-oxohexanoic acid |
| SMILES | CSCCC(NC(=O)CN)C(=O)C(N)C(=O)O |
| InChI | InChI=1S/C9H17N3O4S/c1-17-3-2-5(12-6(13)4-10)8(14)7(11)9(15)16/h5,7H,2-4,10-11H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | HCCAAKQLRPZHOH-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|