About 6-methylquinolin-5-amine
6-methylquinolin-5-amine (PubChem CID 3022182) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 6-methylquinolin-5-amine.
Molecular Properties
| Compound Name | 6-methylquinolin-5-amine |
| PubChem CID | 3022182 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 6-methylquinolin-5-amine |
| SMILES | Cc1ccc2ncccc2c1N |
| InChI | InChI=1S/C10H10N2/c1-7-4-5-9-8(10(7)11)3-2-6-12-9/h2-6H,11H2,1H3 |
| InChIKey | KQIDQFHIEFDWPM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-methylquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylquinolin-5-amine?
The IUPAC name of 6-methylquinolin-5-amine (CID 3022182) is 6-methylquinolin-5-amine.
What is the SMILES notation for 6-methylquinolin-5-amine?
The canonical SMILES for 6-methylquinolin-5-amine is Cc1ccc2ncccc2c1N.
What is the InChIKey of 6-methylquinolin-5-amine?
The InChIKey is KQIDQFHIEFDWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-7-4-5-9-8(10(7)11)3-2-6-12-9/h2-6H,11H2,1H3.
What are the key properties of 6-methylquinolin-5-amine?
6-methylquinolin-5-amine has a molecular weight of 158.20 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylquinolin-5-amine is sourced from PubChem (CID 3022182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).