C6H11Cl2N3O — CID 3023919
6-methoxypyridine-2,3-diamine;dihydrochloride (PubChem CID 3023919) has the molecular formula C6H11Cl2N3O and a molecular weight of 212.08 g/mol. Its IUPAC name is 6-methoxypyridine-2,3-diamine;dihydrochloride.
| Compound Name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 3023919 |
| Molecular Formula | C6H11Cl2N3O |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
| SMILES | COc1ccc(N)c(N)n1.Cl.Cl |
| InChI | InChI=1S/C6H9N3O.2ClH/c1-10-5-3-2-4(7)6(8)9-5;;/h2-3H,7H2,1H3,(H2,8,9);2*1H |
| InChIKey | HFTXXPTXSCLIIP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |