C6H9N3O — CID 3023920
6-methoxypyridine-2,3-diamine (PubChem CID 3023920) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 6-methoxypyridine-2,3-diamine.
| Compound Name | 6-methoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 3023920 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 6-methoxypyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C6H9N3O/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,7H2,1H3,(H2,8,9) |
| InChIKey | WEPOCTWSRWLQLL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |