C17H37N3 — CID 3025802
1,1,3,3-tetrabutylguanidine (PubChem CID 3025802) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is 1,1,3,3-tetrabutylguanidine.
| Compound Name | 1,1,3,3-tetrabutylguanidine |
|---|---|
| PubChem CID | 3025802 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | 1,1,3,3-tetrabutylguanidine |
| SMILES | [H]N=C(N(CCCC)CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C17H37N3/c1-5-9-13-19(14-10-6-2)17(18)20(15-11-7-3)16-12-8-4/h18H,5-16H2,1-4H3 |
| InChIKey | FXJRXJXSLXNGBY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|