C25H28N4O4 — CID 30263426
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-ethylbenzimidazol-1-yl)acetate (PubChem CID 30263426) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-ethylbenzimidazol-1-yl)acetate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 30263426 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
| SMILES | CCc1nc2ccccc2n1CC(=O)OCC(=O)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C25H28N4O4/c1-2-22-27-20-13-7-8-14-21(20)29(22)15-24(31)33-16-23(30)28-19-12-6-5-11-18(19)25(32)26-17-9-3-4-10-17/h5-8,11-14,17H,2-4,9-10,15-16H2,1H3,(H,26,32)(H,28,30) |
| InChIKey | XOLSESBMHBPJSI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |