About (4-ethyl-3-methylphenyl) carbamate
(4-ethyl-3-methylphenyl) carbamate (PubChem CID 3027931) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (4-ethyl-3-methylphenyl) carbamate.
Molecular Properties
| Compound Name | (4-ethyl-3-methylphenyl) carbamate |
| PubChem CID | 3027931 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4-ethyl-3-methylphenyl) carbamate |
| SMILES | CCc1ccc(OC(N)=O)cc1C |
| InChI | InChI=1S/C10H13NO2/c1-3-8-4-5-9(6-7(8)2)13-10(11)12/h4-6H,3H2,1-2H3,(H2,11,12) |
| InChIKey | BXKLNWJVFXKXFC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethyl-3-methylphenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3-methylphenyl) carbamate?
The IUPAC name of (4-ethyl-3-methylphenyl) carbamate (CID 3027931) is (4-ethyl-3-methylphenyl) carbamate.
What is the SMILES notation for (4-ethyl-3-methylphenyl) carbamate?
The canonical SMILES for (4-ethyl-3-methylphenyl) carbamate is CCc1ccc(OC(N)=O)cc1C.
What is the InChIKey of (4-ethyl-3-methylphenyl) carbamate?
The InChIKey is BXKLNWJVFXKXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-3-8-4-5-9(6-7(8)2)13-10(11)12/h4-6H,3H2,1-2H3,(H2,11,12).
What are the key properties of (4-ethyl-3-methylphenyl) carbamate?
(4-ethyl-3-methylphenyl) carbamate has a molecular weight of 179.22 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3-methylphenyl) carbamate is sourced from PubChem (CID 3027931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).