C16H27NO2 — CID 30295
1-[2-[2-(Diethylamino)ethoxy]phenyl]butan-1-ol (PubChem CID 30295) has the molecular formula C16H27NO2 and a molecular weight of 265.39 g/mol. Its IUPAC name is 1-[2-[2-(diethylamino)ethoxy]phenyl]butan-1-ol.
| Compound Name | 1-[2-[2-(Diethylamino)ethoxy]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 30295 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-[2-[2-(diethylamino)ethoxy]phenyl]butan-1-ol |
| SMILES | CCCC(C1=CC=CC=C1OCCN(CC)CC)O |
| InChIKey | YFHDAZIANBGJRF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | 219 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |