About azanium N-phenylcarbamodithioate
azanium N-phenylcarbamodithioate (PubChem CID 3032377) has the molecular formula C7H10N2S2
and a molecular weight of 186.31 g/mol. Its IUPAC name is azanium N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | azanium N-phenylcarbamodithioate |
| PubChem CID | 3032377 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | azanium N-phenylcarbamodithioate |
| SMILES | S=C([S-])Nc1ccccc1.[NH4+] |
| InChI | InChI=1S/C7H7NS2.H3N/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H3 |
| InChIKey | JSNKIZGODRFYMM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze azanium N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium N-phenylcarbamodithioate?
The IUPAC name of azanium N-phenylcarbamodithioate (CID 3032377) is azanium N-phenylcarbamodithioate.
What is the SMILES notation for azanium N-phenylcarbamodithioate?
The canonical SMILES for azanium N-phenylcarbamodithioate is S=C([S-])Nc1ccccc1.[NH4+].
What is the InChIKey of azanium N-phenylcarbamodithioate?
The InChIKey is JSNKIZGODRFYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS2.H3N/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H3.
What are the key properties of azanium N-phenylcarbamodithioate?
azanium N-phenylcarbamodithioate has a molecular weight of 186.31 g/mol, XLogP of 2.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium N-phenylcarbamodithioate is sourced from PubChem (CID 3032377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).