About [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate
[4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate (PubChem CID 30325925) has the molecular formula C18H12N2O5S
and a molecular weight of 368.37 g/mol. Its IUPAC name is [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate |
| PubChem CID | 30325925 |
| Molecular Formula | C18H12N2O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate |
| SMILES | N#Cc1ccc(S(=O)(=O)Oc2ccc(NC(=O)c3ccco3)cc2)cc1 |
| InChI | InChI=1S/C18H12N2O5S/c19-12-13-3-9-16(10-4-13)26(22,23)25-15-7-5-14(6-8-15)20-18(21)17-2-1-11-24-17/h1-11H,(H,20,21) |
| InChIKey | HKCBOFOWSYVHOA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate?
The IUPAC name of [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate (CID 30325925) is [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate.
What is the SMILES notation for [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate?
The canonical SMILES for [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate is N#Cc1ccc(S(=O)(=O)Oc2ccc(NC(=O)c3ccco3)cc2)cc1.
What is the InChIKey of [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate?
The InChIKey is HKCBOFOWSYVHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O5S/c19-12-13-3-9-16(10-4-13)26(22,23)25-15-7-5-14(6-8-15)20-18(21)17-2-1-11-24-17/h1-11H,(H,20,21).
What are the key properties of [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate?
[4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate has a molecular weight of 368.37 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-2-carbonylamino)phenyl] 4-cyanobenzenesulfonate is sourced from PubChem (CID 30325925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).