C12H24N2O — CID 30327158
2-[4-[(1R,3R)-3-methylcyclopentyl]piperazin-1-yl]ethanol (PubChem CID 30327158) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-[4-[(1R,3R)-3-methylcyclopentyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(1R,3R)-3-methylcyclopentyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 30327158 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-[4-[(1R,3R)-3-methylcyclopentyl]piperazin-1-yl]ethanol |
| SMILES | C[C@@H]1CC[C@@H](N2CCN(CCO)CC2)C1 |
| InChI | InChI=1S/C12H24N2O/c1-11-2-3-12(10-11)14-6-4-13(5-7-14)8-9-15/h11-12,15H,2-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | ABMMEASNTBESRY-VXGBXAGGSA-N |
| XLogP | 0.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |