C22H21N3O3 — CID 30339243
[(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 2-pyridin-3-ylquinoline-4-carboxylate (PubChem CID 30339243) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 2-pyridin-3-ylquinoline-4-carboxylate.
| Compound Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 2-pyridin-3-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 30339243 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 2-pyridin-3-ylquinoline-4-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(-c2cccnc2)nc2ccccc12)C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H21N3O3/c1-15(21(26)25-11-4-5-12-25)28-22(27)18-13-20(16-7-6-10-23-14-16)24-19-9-3-2-8-17(18)19/h2-3,6-10,13-15H,4-5,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | SNMHFDNMFBKPCU-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |