C22H26N2O3 — CID 8944516
[(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate (PubChem CID 8944516) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate.
| Compound Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8944516 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(C2CC2)nc2ccccc12)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-15(21(25)24-12-6-2-3-7-13-24)27-22(26)18-14-20(16-10-11-16)23-19-9-5-4-8-17(18)19/h4-5,8-9,14-16H,2-3,6-7,10-13H2,1H3/t15-/m1/s1 |
| InChIKey | ZQKYDJOGJZYTNL-OAHLLOKOSA-N |
| XLogP | 4.06 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |