C24H22N2O4 — CID 8944498
[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate (PubChem CID 8944498) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate.
| Compound Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8944498 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-cyclopropylquinoline-4-carboxylate |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)OC(=O)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H22N2O4/c1-14(27)17-7-3-5-9-20(17)26-23(28)15(2)30-24(29)19-13-22(16-11-12-16)25-21-10-6-4-8-18(19)21/h3-10,13,15-16H,11-12H2,1-2H3,(H,26,28)/t15-/m1/s1 |
| InChIKey | GCZFGFFYQJTZTE-OAHLLOKOSA-N |
| XLogP | 4.50 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |