C11H13NO5 — CID 3037937
[2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-hydroxyethyl] carbamate (PubChem CID 3037937) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-hydroxyethyl] carbamate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 3037937 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-1-hydroxyethyl] carbamate |
| SMILES | NC(=O)OC(O)CC1COc2ccccc2O1 |
| InChI | InChI=1S/C11H13NO5/c12-11(14)17-10(13)5-7-6-15-8-3-1-2-4-9(8)16-7/h1-4,7,10,13H,5-6H2,(H2,12,14) |
| InChIKey | MVALIGSLMJUNEO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|