C22H27ClN2O5S — CID 30394625
ethyl 4-[[2-(4-tert-butyl-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate (PubChem CID 30394625) has the molecular formula C22H27ClN2O5S and a molecular weight of 466.99 g/mol. Its IUPAC name is ethyl 4-[[2-(4-tert-butyl-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 4-[[2-(4-tert-butyl-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 30394625 |
| Molecular Formula | C22H27ClN2O5S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | ethyl 4-[[2-(4-tert-butyl-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(C(C)(C)C)cc2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C22H27ClN2O5S/c1-6-30-21(27)18-12-9-16(13-19(18)23)24-20(26)14-25(31(5,28)29)17-10-7-15(8-11-17)22(2,3)4/h7-13H,6,14H2,1-5H3,(H,24,26) |
| InChIKey | NJGYMIUNJOUHBT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |