C18H18BrClN2O5S — CID 46771686
ethyl 4-[[2-(2-bromo-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate (PubChem CID 46771686) has the molecular formula C18H18BrClN2O5S and a molecular weight of 489.78 g/mol. Its IUPAC name is ethyl 4-[[2-(2-bromo-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 4-[[2-(2-bromo-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 46771686 |
| Molecular Formula | C18H18BrClN2O5S |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 487.98 |
| IUPAC Name | ethyl 4-[[2-(2-bromo-N-methylsulfonylanilino)acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccccc2Br)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C18H18BrClN2O5S/c1-3-27-18(24)13-9-8-12(10-15(13)20)21-17(23)11-22(28(2,25)26)16-7-5-4-6-14(16)19/h4-10H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | WYTKNRBTJPYHQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |