C16H16ClN3O3S — CID 30397839
(3R)-2-[(6-chloro-3-pyridinyl)sulfonyl]-N-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 30397839) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is (3R)-2-[(6-chloro-3-pyridinyl)sulfonyl]-N-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-[(6-chloro-3-pyridinyl)sulfonyl]-N-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30397839 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (3R)-2-[(6-chloro-3-pyridinyl)sulfonyl]-N-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CNC(=O)[C@H]1Cc2ccccc2CN1S(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-18-16(21)14-8-11-4-2-3-5-12(11)10-20(14)24(22,23)13-6-7-15(17)19-9-13/h2-7,9,14H,8,10H2,1H3,(H,18,21)/t14-/m1/s1 |
| InChIKey | GGZGXANKHILVGV-CQSZACIVSA-N |
| XLogP | 1.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|