About 7-methylheptadecane
7-methylheptadecane (PubChem CID 30398) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 7-methylheptadecane.
Molecular Properties
| Compound Name | 7-methylheptadecane |
| PubChem CID | 30398 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 7-methylheptadecane |
| SMILES | CCCCCCCCCCC(C)CCCCCC |
| InChI | InChI=1S/C18H38/c1-4-6-8-10-11-12-13-15-17-18(3)16-14-9-7-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | AZGIFKCGYRMPKP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methylheptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylheptadecane?
The IUPAC name of 7-methylheptadecane (CID 30398) is 7-methylheptadecane.
What is the SMILES notation for 7-methylheptadecane?
The canonical SMILES for 7-methylheptadecane is CCCCCCCCCCC(C)CCCCCC.
What is the InChIKey of 7-methylheptadecane?
The InChIKey is AZGIFKCGYRMPKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-4-6-8-10-11-12-13-15-17-18(3)16-14-9-7-5-2/h18H,4-17H2,1-3H3.
What are the key properties of 7-methylheptadecane?
7-methylheptadecane has a molecular weight of 254.50 g/mol, XLogP of 7.12, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylheptadecane is sourced from PubChem (CID 30398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).