About 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine
6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine (PubChem CID 3041841) has the molecular formula C14H17N5OS
and a molecular weight of 303.39 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine |
| PubChem CID | 3041841 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine |
| SMILES | Nc1nc2ccc3c(ncn3CCN3CCOCC3)c2s1 |
| InChI | InChI=1S/C14H17N5OS/c15-14-17-10-1-2-11-12(13(10)21-14)16-9-19(11)4-3-18-5-7-20-8-6-18/h1-2,9H,3-8H2,(H2,15,17) |
| InChIKey | DIYYYZYZCKUUOL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine?
The IUPAC name of 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine (CID 3041841) is 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine.
What is the SMILES notation for 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine?
The canonical SMILES for 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine is Nc1nc2ccc3c(ncn3CCN3CCOCC3)c2s1.
What is the InChIKey of 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine?
The InChIKey is DIYYYZYZCKUUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5OS/c15-14-17-10-1-2-11-12(13(10)21-14)16-9-19(11)4-3-18-5-7-20-8-6-18/h1-2,9H,3-8H2,(H2,15,17).
What are the key properties of 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine?
6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine has a molecular weight of 303.39 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-morpholin-4-ylethyl)imidazo[4,5-g][1,3]benzothiazol-2-amine is sourced from PubChem (CID 3041841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).