C11H20BrN — CID 3042877
7-methylidene-4-propan-2-yl-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide (PubChem CID 3042877) has the molecular formula C11H20BrN and a molecular weight of 246.19 g/mol. Its IUPAC name is 7-methylidene-4-propan-2-yl-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide.
| Compound Name | 7-methylidene-4-propan-2-yl-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide |
|---|---|
| PubChem CID | 3042877 |
| Molecular Formula | C11H20BrN |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 7-methylidene-4-propan-2-yl-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide |
| SMILES | C=C1CC[N+]2(C(C)C)CCCC12.[Br-] |
| InChI | InChI=1S/C11H20N.BrH/c1-9(2)12-7-4-5-11(12)10(3)6-8-12;/h9,11H,3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FSSCFKYHAIITFK-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|