C11H15N3O2 — CID 3043225
3-butyl-1-methyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 3043225) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-butyl-1-methyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-butyl-1-methyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3043225 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-butyl-1-methyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)c2[nH]ccc2n(C)c1=O |
| InChI | InChI=1S/C11H15N3O2/c1-3-4-7-14-10(15)9-8(5-6-12-9)13(2)11(14)16/h5-6,12H,3-4,7H2,1-2H3 |
| InChIKey | VJIYSQDBLOUIID-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |