C24H21N5O3S — CID 30454501
N-[4-oxo-4-[2-(2-pyridin-2-ylquinoline-4-carbonyl)hydrazinyl]butyl]thiophene-3-carboxamide (PubChem CID 30454501) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[4-oxo-4-[2-(2-pyridin-2-ylquinoline-4-carbonyl)hydrazinyl]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[2-(2-pyridin-2-ylquinoline-4-carbonyl)hydrazinyl]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30454501 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[4-oxo-4-[2-(2-pyridin-2-ylquinoline-4-carbonyl)hydrazinyl]butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NNC(=O)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C24H21N5O3S/c30-22(9-5-12-26-23(31)16-10-13-33-15-16)28-29-24(32)18-14-21(20-8-3-4-11-25-20)27-19-7-2-1-6-17(18)19/h1-4,6-8,10-11,13-15H,5,9,12H2,(H,26,31)(H,28,30)(H,29,32) |
| InChIKey | MOJHWQZCFLCEBB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|