C15H12ClFN2O5S — CID 30474601
[2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 5-nitrothiophene-2-carboxylate (PubChem CID 30474601) has the molecular formula C15H12ClFN2O5S and a molecular weight of 386.79 g/mol. Its IUPAC name is [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 30474601 |
| Molecular Formula | C15H12ClFN2O5S |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)COC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H12ClFN2O5S/c1-18(7-9-10(16)3-2-4-11(9)17)13(20)8-24-15(21)12-5-6-14(25-12)19(22)23/h2-6H,7-8H2,1H3 |
| InChIKey | BCABPDUOZOOQJQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|