C21H24ClN3O2S — CID 3048190
3-[bis(prop-2-enyl)amino]propyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate;hydrochloride (PubChem CID 3048190) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)amino]propyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate;hydrochloride.
| Compound Name | 3-[bis(prop-2-enyl)amino]propyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 3048190 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[bis(prop-2-enyl)amino]propyl pyrido[3,2-b][1,4]benzothiazine-10-carboxylate;hydrochloride |
| SMILES | C=CCN(CC=C)CCCOC(=O)N1c2ccccc2Sc2cccnc21.Cl |
| InChI | InChI=1S/C21H23N3O2S.ClH/c1-3-13-23(14-4-2)15-8-16-26-21(25)24-17-9-5-6-10-18(17)27-19-11-7-12-22-20(19)24;/h3-7,9-12H,1-2,8,13-16H2;1H |
| InChIKey | CXRZHQBKHBCBQN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|