C12H16ClNO3 — CID 3048741
(1-chloro-3-phenoxypropan-2-yl) N-ethylcarbamate (PubChem CID 3048741) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is (1-chloro-3-phenoxypropan-2-yl) N-ethylcarbamate.
| Compound Name | (1-chloro-3-phenoxypropan-2-yl) N-ethylcarbamate |
|---|---|
| PubChem CID | 3048741 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1-chloro-3-phenoxypropan-2-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC(CCl)COc1ccccc1 |
| InChI | InChI=1S/C12H16ClNO3/c1-2-14-12(15)17-11(8-13)9-16-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,14,15) |
| InChIKey | AYLZFWRLSOHSND-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|