About 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate
1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate (PubChem CID 118910868) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate.
Molecular Properties
| Compound Name | 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate |
| PubChem CID | 118910868 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate |
| SMILES | CNCCNC(=O)OC(C)COc1ccccc1 |
| InChI | InChI=1S/C13H20N2O3/c1-11(18-13(16)15-9-8-14-2)10-17-12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3,(H,15,16) |
| InChIKey | OKYWYXASWNEKBR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate?
The IUPAC name of 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate (CID 118910868) is 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate.
What is the SMILES notation for 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate?
The canonical SMILES for 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate is CNCCNC(=O)OC(C)COc1ccccc1.
What is the InChIKey of 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate?
The InChIKey is OKYWYXASWNEKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-11(18-13(16)15-9-8-14-2)10-17-12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3,(H,15,16).
What are the key properties of 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate?
1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate has a molecular weight of 252.31 g/mol, XLogP of 1.40, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxypropan-2-yl N-[2-(methylamino)ethyl]carbamate is sourced from PubChem (CID 118910868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).