About O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate
O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate (PubChem CID 503655) has the molecular formula C24H23NO4S
and a molecular weight of 421.52 g/mol. Its IUPAC name is O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate.
Molecular Properties
| Compound Name | O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate |
| PubChem CID | 503655 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate |
| SMILES | CC(COc1ccccc1)OC(=S)N(C(=O)COc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-19(17-27-21-13-7-3-8-14-21)29-24(30)25(20-11-5-2-6-12-20)23(26)18-28-22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3 |
| InChIKey | YYOWZTRRPNMLDR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate?
The IUPAC name of O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate (CID 503655) is O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate.
What is the SMILES notation for O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate?
The canonical SMILES for O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate is CC(COc1ccccc1)OC(=S)N(C(=O)COc1ccccc1)c1ccccc1.
What is the InChIKey of O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate?
The InChIKey is YYOWZTRRPNMLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO4S/c1-19(17-27-21-13-7-3-8-14-21)29-24(30)25(20-11-5-2-6-12-20)23(26)18-28-22-15-9-4-10-16-22/h2-16,19H,17-18H2,1H3.
What are the key properties of O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate?
O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate has a molecular weight of 421.52 g/mol, XLogP of 4.87, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1-phenoxypropan-2-yl) N-(2-phenoxyacetyl)-N-phenylcarbamothioate is sourced from PubChem (CID 503655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).