C32H45Cl2N3O4 — CID 3049745
bis[2-(1-phenylpropan-2-ylamino)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride (PubChem CID 3049745) has the molecular formula C32H45Cl2N3O4 and a molecular weight of 606.64 g/mol. Its IUPAC name is bis[2-(1-phenylpropan-2-ylamino)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride.
| Compound Name | bis[2-(1-phenylpropan-2-ylamino)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 3049745 |
| Molecular Formula | C32H45Cl2N3O4 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | bis[2-(1-phenylpropan-2-ylamino)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
| SMILES | CC1=C(C(=O)OCCNC(C)Cc2ccccc2)C(C)C(C(=O)OCCNC(C)Cc2ccccc2)=C(C)N1.Cl.Cl |
| InChI | InChI=1S/C32H43N3O4.2ClH/c1-22(20-27-12-8-6-9-13-27)33-16-18-38-31(36)29-24(3)30(26(5)35-25(29)4)32(37)39-19-17-34-23(2)21-28-14-10-7-11-15-28;;/h6-15,22-24,33-35H,16-21H2,1-5H3;2*1H |
| InChIKey | GWKUEOPYYBGHDL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|