C15H14F3N3O4S — CID 30502354
N-(4-methyl-3-sulfamoylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 30502354) has the molecular formula C15H14F3N3O4S and a molecular weight of 389.36 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 30502354 |
| Molecular Formula | C15H14F3N3O4S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(C(F)(F)F)ccc2=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H14F3N3O4S/c1-9-2-4-11(6-12(9)26(19,24)25)20-13(22)8-21-7-10(15(16,17)18)3-5-14(21)23/h2-7H,8H2,1H3,(H,20,22)(H2,19,24,25) |
| InChIKey | KTMSZNVWOODNOO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |