About 2-(4-methylphenyl)ethyl pyridine-3-carboxylate
2-(4-methylphenyl)ethyl pyridine-3-carboxylate (PubChem CID 30515) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)ethyl pyridine-3-carboxylate |
| PubChem CID | 30515 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(4-methylphenyl)ethyl pyridine-3-carboxylate |
| SMILES | Cc1ccc(CCOC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C15H15NO2/c1-12-4-6-13(7-5-12)8-10-18-15(17)14-3-2-9-16-11-14/h2-7,9,11H,8,10H2,1H3 |
| InChIKey | VBKBPKQFPBNSKY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenyl)ethyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)ethyl pyridine-3-carboxylate?
The IUPAC name of 2-(4-methylphenyl)ethyl pyridine-3-carboxylate (CID 30515) is 2-(4-methylphenyl)ethyl pyridine-3-carboxylate.
What is the SMILES notation for 2-(4-methylphenyl)ethyl pyridine-3-carboxylate?
The canonical SMILES for 2-(4-methylphenyl)ethyl pyridine-3-carboxylate is Cc1ccc(CCOC(=O)c2cccnc2)cc1.
What is the InChIKey of 2-(4-methylphenyl)ethyl pyridine-3-carboxylate?
The InChIKey is VBKBPKQFPBNSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-12-4-6-13(7-5-12)8-10-18-15(17)14-3-2-9-16-11-14/h2-7,9,11H,8,10H2,1H3.
What are the key properties of 2-(4-methylphenyl)ethyl pyridine-3-carboxylate?
2-(4-methylphenyl)ethyl pyridine-3-carboxylate has a molecular weight of 241.29 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)ethyl pyridine-3-carboxylate is sourced from PubChem (CID 30515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).