C14H20N2O2S — CID 3051857
1-(1,2-benzothiazol-4-yloxy)-3-(butan-2-ylamino)propan-2-ol (PubChem CID 3051857) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-4-yloxy)-3-(butan-2-ylamino)propan-2-ol.
| Compound Name | 1-(1,2-benzothiazol-4-yloxy)-3-(butan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 3051857 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(1,2-benzothiazol-4-yloxy)-3-(butan-2-ylamino)propan-2-ol |
| SMILES | CCC(C)NCC(O)COc1cccc2sncc12 |
| InChI | InChI=1S/C14H20N2O2S/c1-3-10(2)15-7-11(17)9-18-13-5-4-6-14-12(13)8-16-19-14/h4-6,8,10-11,15,17H,3,7,9H2,1-2H3 |
| InChIKey | TYDIKDRXPYYLES-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |