C23H23N5OS — CID 30526445
2-[1-(2-methylphenyl)imidazol-2-yl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide (PubChem CID 30526445) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)imidazol-2-yl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[1-(2-methylphenyl)imidazol-2-yl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30526445 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-[1-(2-methylphenyl)imidazol-2-yl]sulfanyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]acetamide |
| SMILES | Cc1ccccc1-n1ccnc1SCC(=O)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C23H23N5OS/c1-18-5-2-3-6-21(18)27-16-14-25-23(27)30-17-22(29)24-13-11-19-7-9-20(10-8-19)28-15-4-12-26-28/h2-10,12,14-16H,11,13,17H2,1H3,(H,24,29) |
| InChIKey | GCNUPGZQRLWJLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |