C9H18O5S2 — CID 3053238
1,1-dioxo-4-pentylsulfonylthiolan-3-ol (PubChem CID 3053238) has the molecular formula C9H18O5S2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,1-dioxo-4-pentylsulfonylthiolan-3-ol.
| Compound Name | 1,1-dioxo-4-pentylsulfonylthiolan-3-ol |
|---|---|
| PubChem CID | 3053238 |
| Molecular Formula | C9H18O5S2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1,1-dioxo-4-pentylsulfonylthiolan-3-ol |
| SMILES | CCCCCS(=O)(=O)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C9H18O5S2/c1-2-3-4-5-16(13,14)9-7-15(11,12)6-8(9)10/h8-10H,2-7H2,1H3 |
| InChIKey | XZKJGVVTVFWICZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|