C14H22O5S2 — CID 98141711
(1R,2S,5S,6R,7R)-3,3-dioxo-6-pentylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ol (PubChem CID 98141711) has the molecular formula C14H22O5S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1R,2S,5S,6R,7R)-3,3-dioxo-6-pentylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ol.
| Compound Name | (1R,2S,5S,6R,7R)-3,3-dioxo-6-pentylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ol |
|---|---|
| PubChem CID | 98141711 |
| Molecular Formula | C14H22O5S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (1R,2S,5S,6R,7R)-3,3-dioxo-6-pentylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-en-5-ol |
| SMILES | CCCCCS(=O)(=O)[C@]12[C@@H](O)CS(=O)(=O)[C@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H22O5S2/c1-2-3-4-7-21(18,19)14-11-6-5-10(8-11)13(14)20(16,17)9-12(14)15/h5-6,10-13,15H,2-4,7-9H2,1H3/t10-,11-,12-,13-,14+/m0/s1 |
| InChIKey | YFJIVNGJHLTYHH-HTVCTNPSSA-N |
| XLogP | 0.69 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|