C18H30N4OS — CID 30540760
3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 30540760) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 30540760 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)NCCCN2CCCCC2)c(C)n1 |
| InChI | InChI=1S/C18H30N4OS/c1-14-16(15(2)21-18(20-14)24-3)8-9-17(23)19-10-7-13-22-11-5-4-6-12-22/h4-13H2,1-3H3,(H,19,23) |
| InChIKey | SEUSNLVRIDWOOE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|