C19H32N4O2S — CID 55629292
3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide (PubChem CID 55629292) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide |
|---|---|
| PubChem CID | 55629292 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)NCCCN2CC(C)OC(C)C2)c(C)n1 |
| InChI | InChI=1S/C19H32N4O2S/c1-13-11-23(12-14(2)25-13)10-6-9-20-18(24)8-7-17-15(3)21-19(26-5)22-16(17)4/h13-14H,6-12H2,1-5H3,(H,20,24) |
| InChIKey | YWJSPFLMZVNYNN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|