C26H30N2O5S — CID 30558942
ethyl 1-[2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetyl]piperidine-4-carboxylate (PubChem CID 30558942) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is ethyl 1-[2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 30558942 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | ethyl 1-[2-[3-[(2-methylphenyl)methylsulfonyl]indol-1-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2cc(S(=O)(=O)Cc3ccccc3C)c3ccccc32)CC1 |
| InChI | InChI=1S/C26H30N2O5S/c1-3-33-26(30)20-12-14-27(15-13-20)25(29)17-28-16-24(22-10-6-7-11-23(22)28)34(31,32)18-21-9-5-4-8-19(21)2/h4-11,16,20H,3,12-15,17-18H2,1-2H3 |
| InChIKey | BIEIJAZQXBCKOR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |