C15H16F3N3S — CID 3056217
2-piperazin-1-yl-4-(2,2,2-trifluoro-1-phenylethyl)-1,3-thiazole (PubChem CID 3056217) has the molecular formula C15H16F3N3S and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-(2,2,2-trifluoro-1-phenylethyl)-1,3-thiazole.
| Compound Name | 2-piperazin-1-yl-4-(2,2,2-trifluoro-1-phenylethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 3056217 |
| Molecular Formula | C15H16F3N3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-piperazin-1-yl-4-(2,2,2-trifluoro-1-phenylethyl)-1,3-thiazole |
| SMILES | FC(F)(F)C(c1ccccc1)c1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C15H16F3N3S/c16-15(17,18)13(11-4-2-1-3-5-11)12-10-22-14(20-12)21-8-6-19-7-9-21/h1-5,10,13,19H,6-9H2 |
| InChIKey | UOBMMCJACYDGSH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |