C19H25N5O3S — CID 30584271
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 30584271) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 30584271 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCC(C)CC2)s1 |
| InChI | InChI=1S/C19H25N5O3S/c1-3-4-5-17-21-22-19(28-17)20-18(25)15-12-14(24(26)27)6-7-16(15)23-10-8-13(2)9-11-23/h6-7,12-13H,3-5,8-11H2,1-2H3,(H,20,22,25) |
| InChIKey | DTNXCONNYINZQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|