C13H19N3O4 — CID 3059255
1-carbamoyl-1-(3,4-dimethoxyphenyl)-3-propylurea (PubChem CID 3059255) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-carbamoyl-1-(3,4-dimethoxyphenyl)-3-propylurea.
| Compound Name | 1-carbamoyl-1-(3,4-dimethoxyphenyl)-3-propylurea |
|---|---|
| PubChem CID | 3059255 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-carbamoyl-1-(3,4-dimethoxyphenyl)-3-propylurea |
| SMILES | CCCNC(=O)N(C(N)=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H19N3O4/c1-4-7-15-13(18)16(12(14)17)9-5-6-10(19-2)11(8-9)20-3/h5-6,8H,4,7H2,1-3H3,(H2,14,17)(H,15,18) |
| InChIKey | MWCRAKFASCCORX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |