C21H18N6O4S — CID 30599206
N'-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbonyl)-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 30599206) has the molecular formula C21H18N6O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbonyl)-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbonyl)-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 30599206 |
| Molecular Formula | C21H18N6O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N'-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbonyl)-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)c1cnc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C21H18N6O4S/c1-11-15(32-19(23-11)12-7-5-4-6-8-12)18(29)25-24-17(28)13-9-14-16(22-10-13)26(2)21(31)27(3)20(14)30/h4-10H,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | NZIVPKLDTDVJRQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|