C21H25NO — CID 3060419
3-(1-cyclopropylethylideneamino)-2-methyl-1,1-diphenylpropan-1-ol (PubChem CID 3060419) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-(1-cyclopropylethylideneamino)-2-methyl-1,1-diphenylpropan-1-ol.
| Compound Name | 3-(1-cyclopropylethylideneamino)-2-methyl-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 3060419 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3-(1-cyclopropylethylideneamino)-2-methyl-1,1-diphenylpropan-1-ol |
| SMILES | C/C(=N\CC(C)C(O)(c1ccccc1)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H25NO/c1-16(15-22-17(2)18-13-14-18)21(23,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,16,18,23H,13-15H2,1-2H3/b22-17+ |
| InChIKey | BOGQPJQEDBSNCV-OQKWZONESA-N |
| XLogP | 4.43 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|