C19H28ClN3O3 — CID 3062692
1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-(1-methylpyrazol-4-yl)propan-1-one;hydrochloride (PubChem CID 3062692) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-(1-methylpyrazol-4-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-(1-methylpyrazol-4-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 3062692 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-(1-methylpyrazol-4-yl)propan-1-one;hydrochloride |
| SMILES | CCCNCC(O)COc1ccccc1C(=O)CCc1cnn(C)c1.Cl |
| InChI | InChI=1S/C19H27N3O3.ClH/c1-3-10-20-12-16(23)14-25-19-7-5-4-6-17(19)18(24)9-8-15-11-21-22(2)13-15;/h4-7,11,13,16,20,23H,3,8-10,12,14H2,1-2H3;1H |
| InChIKey | FEMDBBSOONMJEI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|