C26H36ClNO4 — CID 16638076
[1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl] 2,2-dimethylpropanoate;hydrochloride (PubChem CID 16638076) has the molecular formula C26H36ClNO4 and a molecular weight of 462.03 g/mol. Its IUPAC name is [1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl] 2,2-dimethylpropanoate;hydrochloride.
| Compound Name | [1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl] 2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 16638076 |
| Molecular Formula | C26H36ClNO4 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | [1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl] 2,2-dimethylpropanoate;hydrochloride |
| SMILES | CCCNCC(COc1ccccc1C(=O)CCc1ccccc1)OC(=O)C(C)(C)C.Cl |
| InChI | InChI=1S/C26H35NO4.ClH/c1-5-17-27-18-21(31-25(29)26(2,3)4)19-30-24-14-10-9-13-22(24)23(28)16-15-20-11-7-6-8-12-20;/h6-14,21,27H,5,15-19H2,1-4H3;1H |
| InChIKey | FPOCCEADMCERJL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|