C13H28N2O2+2 — CID 3065836
2-(1,1-dimethylpiperidin-1-ium-3-carbonyl)oxyethyl-trimethylazanium (PubChem CID 3065836) has the molecular formula C13H28N2O2+2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(1,1-dimethylpiperidin-1-ium-3-carbonyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(1,1-dimethylpiperidin-1-ium-3-carbonyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 3065836 |
| Molecular Formula | C13H28N2O2+2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 2-(1,1-dimethylpiperidin-1-ium-3-carbonyl)oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)C1CCC[N+](C)(C)C1 |
| InChI | InChI=1S/C13H28N2O2/c1-14(2,3)9-10-17-13(16)12-7-6-8-15(4,5)11-12/h12H,6-11H2,1-5H3/q+2 |
| InChIKey | SERTZVLJTRGMPQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|