C14H30N2O2+2 — CID 76962904
trimethyl-[2-[(2R,6S)-1,1,6-trimethylpiperidin-1-ium-2-carbonyl]oxyethyl]azanium (PubChem CID 76962904) has the molecular formula C14H30N2O2+2 and a molecular weight of 258.41 g/mol. Its IUPAC name is trimethyl-[2-[(2R,6S)-1,1,6-trimethylpiperidin-1-ium-2-carbonyl]oxyethyl]azanium.
| Compound Name | trimethyl-[2-[(2R,6S)-1,1,6-trimethylpiperidin-1-ium-2-carbonyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 76962904 |
| Molecular Formula | C14H30N2O2+2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | trimethyl-[2-[(2R,6S)-1,1,6-trimethylpiperidin-1-ium-2-carbonyl]oxyethyl]azanium |
| SMILES | C[C@H]1CCC[C@H](C(=O)OCC[N+](C)(C)C)[N+]1(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-12-8-7-9-13(16(12,5)6)14(17)18-11-10-15(2,3)4/h12-13H,7-11H2,1-6H3/q+2/t12-,13+/m0/s1 |
| InChIKey | ZRPJBDLMSFSJJW-QWHCGFSZSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|