C11H22N2O2S — CID 11311175
2-[(4S)-2,2-dimethyl-1,3-thiazolidin-3-ide-4-carbonyl]oxyethyl-trimethylazanium (PubChem CID 11311175) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-thiazolidin-3-ide-4-carbonyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-thiazolidin-3-ide-4-carbonyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11311175 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-thiazolidin-3-ide-4-carbonyl]oxyethyl-trimethylazanium |
| SMILES | CC1(C)[N-][C@@H](C(=O)OCC[N+](C)(C)C)CS1 |
| InChI | InChI=1S/C11H22N2O2S/c1-11(2)12-9(8-16-11)10(14)15-7-6-13(3,4)5/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | QYIRSRFTILGHNJ-SECBINFHSA-N |
| XLogP | 1.46 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|